C46H39N3O4 — CID 149132602
5-[7-(7-amino-2-oxochromen-3-yl)-9-phenylcarbazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 149132602) has the molecular formula C46H39N3O4 and a molecular weight of 697.84 g/mol. Its IUPAC name is 5-[7-(7-amino-2-oxochromen-3-yl)-9-phenylcarbazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[7-(7-amino-2-oxochromen-3-yl)-9-phenylcarbazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 149132602 |
| Molecular Formula | C46H39N3O4 |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 697.29 |
| IUPAC Name | 5-[7-(7-amino-2-oxochromen-3-yl)-9-phenylcarbazol-2-yl]-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1cc(-c2ccc4c5ccc(-c6cc7ccc(N)cc7oc6=O)cc5n(-c5ccccc5)c4c2)c(=O)oc31 |
| InChI | InChI=1S/C46H39N3O4/c1-45(2)16-18-48-19-17-46(3,4)40-41(48)36(45)22-29-21-35(44(51)53-42(29)40)27-12-15-33-32-14-11-26(34-20-28-10-13-30(47)25-39(28)52-43(34)50)23-37(32)49(38(33)24-27)31-8-6-5-7-9-31/h5-15,20-25H,16-19,47H2,1-4H3 |
| InChIKey | RCZATOMWGLMAHG-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|