C48H30N2O4 — CID 142252770
7-amino-3-[3-[6-[3-(2-oxochromen-3-yl)phenyl]-9-phenylcarbazol-3-yl]phenyl]chromen-2-one (PubChem CID 142252770) has the molecular formula C48H30N2O4 and a molecular weight of 698.78 g/mol. Its IUPAC name is 7-amino-3-[3-[6-[3-(2-oxochromen-3-yl)phenyl]-9-phenylcarbazol-3-yl]phenyl]chromen-2-one.
| Compound Name | 7-amino-3-[3-[6-[3-(2-oxochromen-3-yl)phenyl]-9-phenylcarbazol-3-yl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 142252770 |
| Molecular Formula | C48H30N2O4 |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 7-amino-3-[3-[6-[3-(2-oxochromen-3-yl)phenyl]-9-phenylcarbazol-3-yl]phenyl]chromen-2-one |
| SMILES | Nc1ccc2cc(-c3cccc(-c4ccc5c(c4)c4cc(-c6cccc(-c7cc8ccccc8oc7=O)c6)ccc4n5-c4ccccc4)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C48H30N2O4/c49-37-19-16-36-27-40(48(52)54-46(36)28-37)34-12-7-10-30(23-34)32-18-21-44-42(25-32)41-24-31(17-20-43(41)50(44)38-13-2-1-3-14-38)29-9-6-11-33(22-29)39-26-35-8-4-5-15-45(35)53-47(39)51/h1-28H,49H2 |
| InChIKey | PDOUMUJGSQCBSB-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|