C30H31NO5 — CID 72630079
4-[2-methyl-3-oxo-3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)prop-1-enyl]benzoic acid (PubChem CID 72630079) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[2-methyl-3-oxo-3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[2-methyl-3-oxo-3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 72630079 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 4-[2-methyl-3-oxo-3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(=Cc1ccc(C(=O)O)cc1)C(=O)c1cc2cc3c4c(c2oc1=O)C(C)(C)CCN4CCC3(C)C |
| InChI | InChI=1S/C30H31NO5/c1-17(14-18-6-8-19(9-7-18)27(33)34)25(32)21-15-20-16-22-24-23(26(20)36-28(21)35)30(4,5)11-13-31(24)12-10-29(22,2)3/h6-9,14-16H,10-13H2,1-5H3,(H,33,34) |
| InChIKey | LOBYKBSJTRSYCT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|