C20H20O3 — CID 146412094
7-(3-hydroxypentyl)-3-phenylchromen-2-one (PubChem CID 146412094) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 7-(3-hydroxypentyl)-3-phenylchromen-2-one.
| Compound Name | 7-(3-hydroxypentyl)-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 146412094 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 7-(3-hydroxypentyl)-3-phenylchromen-2-one |
| SMILES | CCC(O)CCc1ccc2cc(-c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H20O3/c1-2-17(21)11-9-14-8-10-16-13-18(15-6-4-3-5-7-15)20(22)23-19(16)12-14/h3-8,10,12-13,17,21H,2,9,11H2,1H3 |
| InChIKey | BHNKGWICWMPHGN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|