C19H18O4 — CID 58402410
7-(3-hydroxypropyl)-3-(4-methoxyphenyl)chromen-2-one (PubChem CID 58402410) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 7-(3-hydroxypropyl)-3-(4-methoxyphenyl)chromen-2-one.
| Compound Name | 7-(3-hydroxypropyl)-3-(4-methoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 58402410 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 7-(3-hydroxypropyl)-3-(4-methoxyphenyl)chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(CCCO)cc3oc2=O)cc1 |
| InChI | InChI=1S/C19H18O4/c1-22-16-8-6-14(7-9-16)17-12-15-5-4-13(3-2-10-20)11-18(15)23-19(17)21/h4-9,11-12,20H,2-3,10H2,1H3 |
| InChIKey | OKQILFXHDYKHOW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|