C45H48O5 — CID 153454826
7-[3-hydroxy-5-[2-oxo-3-(4-pentylphenyl)chromen-7-yl]pentyl]-3-(4-pentylphenyl)chromen-2-one (PubChem CID 153454826) has the molecular formula C45H48O5 and a molecular weight of 668.87 g/mol. Its IUPAC name is 7-[3-hydroxy-5-[2-oxo-3-(4-pentylphenyl)chromen-7-yl]pentyl]-3-(4-pentylphenyl)chromen-2-one.
| Compound Name | 7-[3-hydroxy-5-[2-oxo-3-(4-pentylphenyl)chromen-7-yl]pentyl]-3-(4-pentylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 153454826 |
| Molecular Formula | C45H48O5 |
| Molecular Weight | 668.87 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 7-[3-hydroxy-5-[2-oxo-3-(4-pentylphenyl)chromen-7-yl]pentyl]-3-(4-pentylphenyl)chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(CCC(O)CCc4ccc5cc(-c6ccc(CCCCC)cc6)c(=O)oc5c4)cc3oc2=O)cc1 |
| InChI | InChI=1S/C45H48O5/c1-3-5-7-9-31-11-19-35(20-12-31)40-29-37-23-15-33(27-42(37)49-44(40)47)17-25-39(46)26-18-34-16-24-38-30-41(45(48)50-43(38)28-34)36-21-13-32(14-22-36)10-8-6-4-2/h11-16,19-24,27-30,39,46H,3-10,17-18,25-26H2,1-2H3 |
| InChIKey | KANKSNQLJXLDIA-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.87 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|