C21H20N2O2 — CID 118041632
7-butyl-3-(2-methylimidazo[1,2-a]pyridin-6-yl)chromen-2-one (PubChem CID 118041632) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 7-butyl-3-(2-methylimidazo[1,2-a]pyridin-6-yl)chromen-2-one.
| Compound Name | 7-butyl-3-(2-methylimidazo[1,2-a]pyridin-6-yl)chromen-2-one |
|---|---|
| PubChem CID | 118041632 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 7-butyl-3-(2-methylimidazo[1,2-a]pyridin-6-yl)chromen-2-one |
| SMILES | CCCCc1ccc2cc(-c3ccc4nc(C)cn4c3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H20N2O2/c1-3-4-5-15-6-7-16-11-18(21(24)25-19(16)10-15)17-8-9-20-22-14(2)12-23(20)13-17/h6-13H,3-5H2,1-2H3 |
| InChIKey | MSXSNDZKQDUCRZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|