C29H36O4 — CID 138735827
7-(4-ethenoxy-2,4-dimethylpentan-2-yl)oxy-3-(4-pentylphenyl)chromen-2-one (PubChem CID 138735827) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is 7-(4-ethenoxy-2,4-dimethylpentan-2-yl)oxy-3-(4-pentylphenyl)chromen-2-one.
| Compound Name | 7-(4-ethenoxy-2,4-dimethylpentan-2-yl)oxy-3-(4-pentylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 138735827 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 7-(4-ethenoxy-2,4-dimethylpentan-2-yl)oxy-3-(4-pentylphenyl)chromen-2-one |
| SMILES | C=COC(C)(C)CC(C)(C)Oc1ccc2cc(-c3ccc(CCCCC)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H36O4/c1-7-9-10-11-21-12-14-22(15-13-21)25-18-23-16-17-24(19-26(23)32-27(25)30)33-29(5,6)20-28(3,4)31-8-2/h8,12-19H,2,7,9-11,20H2,1,3-6H3 |
| InChIKey | FUKUDRMNMTWOOG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|