C30H35N3O4S2 — CID 171502572
2-[butyl-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazol-6-yl]sulfanyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 171502572) has the molecular formula C30H35N3O4S2 and a molecular weight of 565.76 g/mol. Its IUPAC name is 2-[butyl-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazol-6-yl]sulfanyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[butyl-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazol-6-yl]sulfanyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171502572 |
| Molecular Formula | C30H35N3O4S2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 2-[butyl-[[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazol-6-yl]sulfanyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CCCC)Sc1ccc2nc(-c3cc4ccc(N(CC)CC)cc4oc3=O)sc2c1 |
| InChI | InChI=1S/C30H35N3O4S2/c1-6-9-14-33(15-16-36-29(34)20(4)5)39-23-12-13-25-27(19-23)38-28(31-25)24-17-21-10-11-22(32(7-2)8-3)18-26(21)37-30(24)35/h10-13,17-19H,4,6-9,14-16H2,1-3,5H3 |
| InChIKey | ORRWFQUPVPWTMS-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|