C25H26N4O4S2 — CID 171502590
3-[6-[bis(2-hydroxyethyl)amino]sulfanyl-1,3-benzothiazol-2-yl]-7-(diethylamino)-2-oxochromene-4-carbonitrile (PubChem CID 171502590) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 3-[6-[bis(2-hydroxyethyl)amino]sulfanyl-1,3-benzothiazol-2-yl]-7-(diethylamino)-2-oxochromene-4-carbonitrile.
| Compound Name | 3-[6-[bis(2-hydroxyethyl)amino]sulfanyl-1,3-benzothiazol-2-yl]-7-(diethylamino)-2-oxochromene-4-carbonitrile |
|---|---|
| PubChem CID | 171502590 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 3-[6-[bis(2-hydroxyethyl)amino]sulfanyl-1,3-benzothiazol-2-yl]-7-(diethylamino)-2-oxochromene-4-carbonitrile |
| SMILES | CCN(CC)c1ccc2c(C#N)c(-c3nc4ccc(SN(CCO)CCO)cc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H26N4O4S2/c1-3-28(4-2)16-5-7-18-19(15-26)23(25(32)33-21(18)13-16)24-27-20-8-6-17(14-22(20)34-24)35-29(9-11-30)10-12-31/h5-8,13-14,30-31H,3-4,9-12H2,1-2H3 |
| InChIKey | XQYSOSBPAWUFCW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|