About (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate
(2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate (PubChem CID 87516961) has the molecular formula C29H26N2O6S
and a molecular weight of 530.60 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate.
Molecular Properties
| Compound Name | (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
| PubChem CID | 87516961 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
| SMILES | CCN(CC)c1ccc2c(C(=O)Oc3c(OC)cccc3OC)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H26N2O6S/c1-5-31(6-2)17-14-15-18-22(16-17)36-29(33)25(27-30-19-10-7-8-13-23(19)38-27)24(18)28(32)37-26-20(34-3)11-9-12-21(26)35-4/h7-16H,5-6H2,1-4H3 |
| InChIKey | SEENIBLVYGHIHR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The IUPAC name of (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate (CID 87516961) is (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate.
What is the SMILES notation for (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The canonical SMILES for (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate is CCN(CC)c1ccc2c(C(=O)Oc3c(OC)cccc3OC)c(-c3nc4ccccc4s3)c(=O)oc2c1.
What is the InChIKey of (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The InChIKey is SEENIBLVYGHIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26N2O6S/c1-5-31(6-2)17-14-15-18-22(16-17)36-29(33)25(27-30-19-10-7-8-13-23(19)38-27)24(18)28(32)37-26-20(34-3)11-9-12-21(26)35-4/h7-16H,5-6H2,1-4H3.
What are the key properties of (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
(2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate has a molecular weight of 530.60 g/mol, XLogP of 6.15, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate is sourced from PubChem (CID 87516961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).