C29H26N2O6S — CID 87516961
(2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate (PubChem CID 87516961) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate.
| Compound Name | (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
|---|---|
| PubChem CID | 87516961 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (2,6-dimethoxyphenyl) 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
| SMILES | CCN(CC)c1ccc2c(C(=O)Oc3c(OC)cccc3OC)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H26N2O6S/c1-5-31(6-2)17-14-15-18-22(16-17)36-29(33)25(27-30-19-10-7-8-13-23(19)38-27)24(18)28(32)37-26-20(34-3)11-9-12-21(26)35-4/h7-16H,5-6H2,1-4H3 |
| InChIKey | SEENIBLVYGHIHR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|