C17H15NO2S — CID 175153186
[2-(1,3-benzothiazol-2-yl)-3-methylphenyl] propanoate (PubChem CID 175153186) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-3-methylphenyl] propanoate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-3-methylphenyl] propanoate |
|---|---|
| PubChem CID | 175153186 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-3-methylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H15NO2S/c1-3-15(19)20-13-9-6-7-11(2)16(13)17-18-12-8-4-5-10-14(12)21-17/h4-10H,3H2,1-2H3 |
| InChIKey | LHTXKWNKCJFTKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|