C17H15NO2S — CID 135069738
[3-methyl-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate (PubChem CID 135069738) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is [3-methyl-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate.
| Compound Name | [3-methyl-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 135069738 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [3-methyl-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C)c1-c1nc2cc(C)ccc2s1 |
| InChI | InChI=1S/C17H15NO2S/c1-10-7-8-15-13(9-10)18-17(21-15)16-11(2)5-4-6-14(16)20-12(3)19/h4-9H,1-3H3 |
| InChIKey | CKMMERXPQQMWMU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|