C16H12FNO2S — CID 135066864
[3-fluoro-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate (PubChem CID 135066864) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is [3-fluoro-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate.
| Compound Name | [3-fluoro-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 135066864 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [3-fluoro-2-(5-methyl-1,3-benzothiazol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(F)c1-c1nc2cc(C)ccc2s1 |
| InChI | InChI=1S/C16H12FNO2S/c1-9-6-7-14-12(8-9)18-16(21-14)15-11(17)4-3-5-13(15)20-10(2)19/h3-8H,1-2H3 |
| InChIKey | FFRRYPPVLILVOD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|