C22H23N2O4PS — CID 135294150
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-4-dimethoxyphosphanylchromen-2-one (PubChem CID 135294150) has the molecular formula C22H23N2O4PS and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-4-dimethoxyphosphanylchromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-4-dimethoxyphosphanylchromen-2-one |
|---|---|
| PubChem CID | 135294150 |
| Molecular Formula | C22H23N2O4PS |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-4-dimethoxyphosphanylchromen-2-one |
| SMILES | CCN(CC)c1ccc2c(P(OC)OC)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H23N2O4PS/c1-5-24(6-2)14-11-12-15-17(13-14)28-22(25)19(20(15)29(26-3)27-4)21-23-16-9-7-8-10-18(16)30-21/h7-13H,5-6H2,1-4H3 |
| InChIKey | HWIHIXVWQFUTLF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|