C21H22N4OS — CID 18730858
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-1-ethylquinoxalin-2-one (PubChem CID 18730858) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-1-ethylquinoxalin-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-1-ethylquinoxalin-2-one |
|---|---|
| PubChem CID | 18730858 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-1-ethylquinoxalin-2-one |
| SMILES | CCN(CC)c1ccc2nc(-c3nc4ccccc4s3)c(=O)n(CC)c2c1 |
| InChI | InChI=1S/C21H22N4OS/c1-4-24(5-2)14-11-12-15-17(13-14)25(6-3)21(26)19(22-15)20-23-16-9-7-8-10-18(16)27-20/h7-13H,4-6H2,1-3H3 |
| InChIKey | FOWRDLVJLFODFX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |