C24H14N2O5S — CID 88988942
3-(1,3-benzothiazol-2-yl)-7-[(3,4-dihydroxyphenyl)methoxy]-2-oxochromene-4-carbonitrile (PubChem CID 88988942) has the molecular formula C24H14N2O5S and a molecular weight of 442.45 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-[(3,4-dihydroxyphenyl)methoxy]-2-oxochromene-4-carbonitrile.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-[(3,4-dihydroxyphenyl)methoxy]-2-oxochromene-4-carbonitrile |
|---|---|
| PubChem CID | 88988942 |
| Molecular Formula | C24H14N2O5S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-[(3,4-dihydroxyphenyl)methoxy]-2-oxochromene-4-carbonitrile |
| SMILES | N#Cc1c(-c2nc3ccccc3s2)c(=O)oc2cc(OCc3ccc(O)c(O)c3)ccc12 |
| InChI | InChI=1S/C24H14N2O5S/c25-11-16-15-7-6-14(30-12-13-5-8-18(27)19(28)9-13)10-20(15)31-24(29)22(16)23-26-17-3-1-2-4-21(17)32-23/h1-10,27-28H,12H2 |
| InChIKey | DFXBFAPWKLCANP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|