C33H37N3O2S — CID 59069746
5-(1,3-benzothiazol-2-yl)-10,16-dibutyl-10,16-dimethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-6-carbonitrile (PubChem CID 59069746) has the molecular formula C33H37N3O2S and a molecular weight of 539.75 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-10,16-dibutyl-10,16-dimethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-6-carbonitrile.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-10,16-dibutyl-10,16-dimethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-6-carbonitrile |
|---|---|
| PubChem CID | 59069746 |
| Molecular Formula | C33H37N3O2S |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-10,16-dibutyl-10,16-dimethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-6-carbonitrile |
| SMILES | CCCCC1(C)CCN2CCC(C)(CCCC)c3c2c1cc1c(C#N)c(-c2nc4ccccc4s2)c(=O)oc31 |
| InChI | InChI=1S/C33H37N3O2S/c1-5-7-13-32(3)15-17-36-18-16-33(4,14-8-6-2)27-28(36)23(32)19-21-22(20-34)26(31(37)38-29(21)27)30-35-24-11-9-10-12-25(24)39-30/h9-12,19H,5-8,13-18H2,1-4H3 |
| InChIKey | VUYOSAOVADRFLC-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|