C23H23N2O2S+ — CID 122381452
7-(diethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one (PubChem CID 122381452) has the molecular formula C23H23N2O2S+ and a molecular weight of 391.52 g/mol. Its IUPAC name is 7-(diethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one |
|---|---|
| PubChem CID | 122381452 |
| Molecular Formula | C23H23N2O2S+ |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 7-(diethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3sc4ccccc4[n+]3C)c(=O)oc2c1 |
| InChI | InChI=1S/C23H23N2O2S/c1-4-25(5-2)18-12-10-16-14-17(23(26)27-20(16)15-18)11-13-22-24(3)19-8-6-7-9-21(19)28-22/h6-15H,4-5H2,1-3H3/q+1 |
| InChIKey | PPMYYDFYGNVLOG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|