C20H17N3O2S — CID 71621990
3-(1,3-benzothiazol-2-yl)-7-piperazin-1-ylchromen-2-one (PubChem CID 71621990) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-piperazin-1-ylchromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-piperazin-1-ylchromen-2-one |
|---|---|
| PubChem CID | 71621990 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-piperazin-1-ylchromen-2-one |
| SMILES | O=c1oc2cc(N3CCNCC3)ccc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H17N3O2S/c24-20-15(19-22-16-3-1-2-4-18(16)26-19)11-13-5-6-14(12-17(13)25-20)23-9-7-21-8-10-23/h1-6,11-12,21H,7-10H2 |
| InChIKey | LRAGEJPCNKMCHP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|