C25H15NO4S — CID 3701094
[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] 3-phenylprop-2-enoate (PubChem CID 3701094) has the molecular formula C25H15NO4S and a molecular weight of 425.47 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] 3-phenylprop-2-enoate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3701094 |
| Molecular Formula | C25H15NO4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)Oc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H15NO4S/c27-23(13-10-16-6-2-1-3-7-16)29-18-12-11-17-14-19(25(28)30-21(17)15-18)24-26-20-8-4-5-9-22(20)31-24/h1-15H |
| InChIKey | AIWDHALZIAUMJG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|