C16H12N2O4S2 — CID 70231665
(2-sulfamoyl-1,3-benzothiazol-5-yl) (E)-3-phenylprop-2-enoate (PubChem CID 70231665) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (2-sulfamoyl-1,3-benzothiazol-5-yl) (E)-3-phenylprop-2-enoate.
| Compound Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 70231665 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) (E)-3-phenylprop-2-enoate |
| SMILES | NS(=O)(=O)c1nc2cc(OC(=O)/C=C/c3ccccc3)ccc2s1 |
| InChI | InChI=1S/C16H12N2O4S2/c17-24(20,21)16-18-13-10-12(7-8-14(13)23-16)22-15(19)9-6-11-4-2-1-3-5-11/h1-10H,(H2,17,20,21)/b9-6+ |
| InChIKey | WMNAHYKJLQRNHS-RMKNXTFCSA-N |
| XLogP | 2.56 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|