C9H8N2O4S2 — CID 13236662
(2-sulfamoyl-1,3-benzothiazol-6-yl) acetate (PubChem CID 13236662) has the molecular formula C9H8N2O4S2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (2-sulfamoyl-1,3-benzothiazol-6-yl) acetate.
| Compound Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) acetate |
|---|---|
| PubChem CID | 13236662 |
| Molecular Formula | C9H8N2O4S2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) acetate |
| SMILES | CC(=O)Oc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C9H8N2O4S2/c1-5(12)15-6-2-3-7-8(4-6)16-9(11-7)17(10,13)14/h2-4H,1H3,(H2,10,13,14) |
| InChIKey | ONLKWCLNLGKXRT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|