C12H15N5O5S2 — CID 145491252
2-[amino-[(Z)-2-amino-3-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]prop-1-enyl]amino]acetic acid (PubChem CID 145491252) has the molecular formula C12H15N5O5S2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]prop-1-enyl]amino]acetic acid.
| Compound Name | 2-[amino-[(Z)-2-amino-3-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]prop-1-enyl]amino]acetic acid |
|---|---|
| PubChem CID | 145491252 |
| Molecular Formula | C12H15N5O5S2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]prop-1-enyl]amino]acetic acid |
| SMILES | N/C(=C\N(N)CC(=O)O)COc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C12H15N5O5S2/c13-7(4-17(14)5-11(18)19)6-22-8-1-2-9-10(3-8)23-12(16-9)24(15,20)21/h1-4H,5-6,13-14H2,(H,18,19)(H2,15,20,21)/b7-4- |
| InChIKey | VWROCDRJDJQTDB-DAXSKMNVSA-N |
| XLogP | -0.62 |
| TPSA | 174.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|