C12H14N2O5S2 — CID 54216091
(2-sulfamoyl-1,3-benzothiazol-6-yl) 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 54216091) has the molecular formula C12H14N2O5S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2-sulfamoyl-1,3-benzothiazol-6-yl) 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54216091 |
| Molecular Formula | C12H14N2O5S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CC(C)(CO)C(=O)Oc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C12H14N2O5S2/c1-12(2,6-15)10(16)19-7-3-4-8-9(5-7)20-11(14-8)21(13,17)18/h3-5,15H,6H2,1-2H3,(H2,13,17,18) |
| InChIKey | PZGVDPLHTAIJHP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|