C12H15N3O5S2 — CID 10641252
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-aminopropanoate (PubChem CID 10641252) has the molecular formula C12H15N3O5S2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-aminopropanoate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-aminopropanoate |
|---|---|
| PubChem CID | 10641252 |
| Molecular Formula | C12H15N3O5S2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-aminopropanoate |
| SMILES | NCCC(=O)OCCOc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C12H15N3O5S2/c13-4-3-11(16)20-6-5-19-8-1-2-9-10(7-8)21-12(15-9)22(14,17)18/h1-2,7H,3-6,13H2,(H2,14,17,18) |
| InChIKey | HUKKTAMNAGLIGS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|