C26H28ClN3O9S2 — CID 10699169
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate (PubChem CID 10699169) has the molecular formula C26H28ClN3O9S2 and a molecular weight of 626.11 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
|---|---|
| PubChem CID | 10699169 |
| Molecular Formula | C26H28ClN3O9S2 |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)OCCOc1ccc2nc(S(N)(=O)=O)sc2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H28N3O5S2.ClHO4/c1-3-20-14-19(18-8-6-5-7-9-18)15-21(4-2)29(20)17-25(30)34-13-12-33-22-10-11-23-24(16-22)35-26(28-23)36(27,31)32;2-1(3,4)5/h5-11,14-16H,3-4,12-13,17H2,1-2H3,(H2,27,31,32);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | JCGFMDYUWUGHIA-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 204.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|