C21H28N4O12S2 — CID 10919029
2-[carboxymethyl-[2-[2-[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl]amino]ethoxy]ethoxy]ethyl]amino]acetic acid (PubChem CID 10919029) has the molecular formula C21H28N4O12S2 and a molecular weight of 592.61 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[2-[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl]amino]ethoxy]ethoxy]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[2-[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl]amino]ethoxy]ethoxy]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 10919029 |
| Molecular Formula | C21H28N4O12S2 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 2-[carboxymethyl-[2-[2-[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl]amino]ethoxy]ethoxy]ethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1nc2ccc(OC(=O)CN(CCOCCOCCN(CC(=O)O)CC(=O)O)CC(=O)O)cc2s1 |
| InChI | InChI=1S/C21H28N4O12S2/c22-39(33,34)21-23-15-2-1-14(9-16(15)38-21)37-20(32)13-25(12-19(30)31)4-6-36-8-7-35-5-3-24(10-17(26)27)11-18(28)29/h1-2,9H,3-8,10-13H2,(H,26,27)(H,28,29)(H,30,31)(H2,22,33,34) |
| InChIKey | HVFXPRVDRFNNGG-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 236.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|