C11H13N3O5S2 — CID 10782727
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-aminoacetate (PubChem CID 10782727) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-aminoacetate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-aminoacetate |
|---|---|
| PubChem CID | 10782727 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 2-aminoacetate |
| SMILES | NCC(=O)OCCOc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C11H13N3O5S2/c12-6-10(15)19-4-3-18-7-1-2-8-9(5-7)20-11(14-8)21(13,16)17/h1-2,5H,3-4,6,12H2,(H2,13,16,17) |
| InChIKey | VMOBXIKIIIRNAD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|