C15H12N2O4S2 — CID 54487226
(2-sulfamoyl-1,3-benzothiazol-5-yl) 2-phenylacetate (PubChem CID 54487226) has the molecular formula C15H12N2O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2-sulfamoyl-1,3-benzothiazol-5-yl) 2-phenylacetate.
| Compound Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) 2-phenylacetate |
|---|---|
| PubChem CID | 54487226 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) 2-phenylacetate |
| SMILES | NS(=O)(=O)c1nc2cc(OC(=O)Cc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C15H12N2O4S2/c16-23(19,20)15-17-12-9-11(6-7-13(12)22-15)21-14(18)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H2,16,19,20) |
| InChIKey | XTEIJGBFTUNSHC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|