C7H5ClN2O2S2 — CID 71551260
5-chloro-1,3-benzothiazole-2-sulfonamide (PubChem CID 71551260) has the molecular formula C7H5ClN2O2S2 and a molecular weight of 248.72 g/mol. Its IUPAC name is 5-chloro-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 5-chloro-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 71551260 |
| Molecular Formula | C7H5ClN2O2S2 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 5-chloro-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C7H5ClN2O2S2/c8-4-1-2-6-5(3-4)10-7(13-6)14(9,11)12/h1-3H,(H2,9,11,12) |
| InChIKey | DZIMJDKDCOZLEK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |