C12H15N3O2S3 — CID 88725682
2,2-dimethyl-N-(2-sulfamoyl-1,3-benzothiazol-5-yl)propanethioamide (PubChem CID 88725682) has the molecular formula C12H15N3O2S3 and a molecular weight of 329.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-sulfamoyl-1,3-benzothiazol-5-yl)propanethioamide.
| Compound Name | 2,2-dimethyl-N-(2-sulfamoyl-1,3-benzothiazol-5-yl)propanethioamide |
|---|---|
| PubChem CID | 88725682 |
| Molecular Formula | C12H15N3O2S3 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2,2-dimethyl-N-(2-sulfamoyl-1,3-benzothiazol-5-yl)propanethioamide |
| SMILES | CC(C)(C)C(=S)Nc1ccc2sc(S(N)(=O)=O)nc2c1 |
| InChI | InChI=1S/C12H15N3O2S3/c1-12(2,3)10(18)14-7-4-5-9-8(6-7)15-11(19-9)20(13,16)17/h4-6H,1-3H3,(H,14,18)(H2,13,16,17) |
| InChIKey | IKKYBNDZBBPBQO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|