C11H12ClN3O4S2 — CID 142667521
2-amino-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfonylamino]butanoic acid (PubChem CID 142667521) has the molecular formula C11H12ClN3O4S2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-amino-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfonylamino]butanoic acid.
| Compound Name | 2-amino-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 142667521 |
| Molecular Formula | C11H12ClN3O4S2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-amino-4-[(5-chloro-1,3-benzothiazol-2-yl)sulfonylamino]butanoic acid |
| SMILES | NC(CCNS(=O)(=O)c1nc2cc(Cl)ccc2s1)C(=O)O |
| InChI | InChI=1S/C11H12ClN3O4S2/c12-6-1-2-9-8(5-6)15-11(20-9)21(18,19)14-4-3-7(13)10(16)17/h1-2,5,7,14H,3-4,13H2,(H,16,17) |
| InChIKey | QRKVTVXVXDTRPC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |