C24H26N4O10S2 — CID 86712489
2-amino-4-[[3-[(3-amino-3-carboxypropyl)sulfamoyl]-6,8-dihydroxypyren-1-yl]sulfonylamino]butanoic acid (PubChem CID 86712489) has the molecular formula C24H26N4O10S2 and a molecular weight of 594.62 g/mol. Its IUPAC name is 2-amino-4-[[3-[(3-amino-3-carboxypropyl)sulfamoyl]-6,8-dihydroxypyren-1-yl]sulfonylamino]butanoic acid.
| Compound Name | 2-amino-4-[[3-[(3-amino-3-carboxypropyl)sulfamoyl]-6,8-dihydroxypyren-1-yl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 86712489 |
| Molecular Formula | C24H26N4O10S2 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 2-amino-4-[[3-[(3-amino-3-carboxypropyl)sulfamoyl]-6,8-dihydroxypyren-1-yl]sulfonylamino]butanoic acid |
| SMILES | NC(CCNS(=O)(=O)c1cc(S(=O)(=O)NCCC(N)C(=O)O)c2ccc3c(O)cc(O)c4ccc1c2c43)C(=O)O |
| InChI | InChI=1S/C24H26N4O10S2/c25-15(23(31)32)5-7-27-39(35,36)19-10-20(40(37,38)28-8-6-16(26)24(33)34)14-4-2-12-18(30)9-17(29)11-1-3-13(19)22(14)21(11)12/h1-4,9-10,15-16,27-30H,5-8,25-26H2,(H,31,32)(H,33,34) |
| InChIKey | SBUDRTIALUGMQF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 259.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|