C12H17ClN2O4S — CID 119972795
methyl 2-(3-aminobutylsulfamoyl)-4-chlorobenzoate (PubChem CID 119972795) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is methyl 2-(3-aminobutylsulfamoyl)-4-chlorobenzoate.
| Compound Name | methyl 2-(3-aminobutylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 119972795 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | methyl 2-(3-aminobutylsulfamoyl)-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1S(=O)(=O)NCCC(C)N |
| InChI | InChI=1S/C12H17ClN2O4S/c1-8(14)5-6-15-20(17,18)11-7-9(13)3-4-10(11)12(16)19-2/h3-4,7-8,15H,5-6,14H2,1-2H3 |
| InChIKey | HPAMEFZGNLGGLA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |