C12H17N3O5S — CID 102930965
methyl 2-(2-acetamidoethylsulfamoyl)-4-aminobenzoate (PubChem CID 102930965) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl 2-(2-acetamidoethylsulfamoyl)-4-aminobenzoate.
| Compound Name | methyl 2-(2-acetamidoethylsulfamoyl)-4-aminobenzoate |
|---|---|
| PubChem CID | 102930965 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | methyl 2-(2-acetamidoethylsulfamoyl)-4-aminobenzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)NCCNC(C)=O |
| InChI | InChI=1S/C12H17N3O5S/c1-8(16)14-5-6-15-21(18,19)11-7-9(13)3-4-10(11)12(17)20-2/h3-4,7,15H,5-6,13H2,1-2H3,(H,14,16) |
| InChIKey | HRMYBUHGUXVPEK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|