C14H22N2O4S — CID 102931597
methyl 4-amino-2-(3,3-dimethylbutan-2-ylsulfamoyl)benzoate (PubChem CID 102931597) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is methyl 4-amino-2-(3,3-dimethylbutan-2-ylsulfamoyl)benzoate.
| Compound Name | methyl 4-amino-2-(3,3-dimethylbutan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 102931597 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methyl 4-amino-2-(3,3-dimethylbutan-2-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C14H22N2O4S/c1-9(14(2,3)4)16-21(18,19)12-8-10(15)6-7-11(12)13(17)20-5/h6-9,16H,15H2,1-5H3 |
| InChIKey | CWSIUQMIRKPFKK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|