C10H15N3O6S2 — CID 102930963
methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate (PubChem CID 102930963) has the molecular formula C10H15N3O6S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate.
| Compound Name | methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 102930963 |
| Molecular Formula | C10H15N3O6S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C10H15N3O6S2/c1-19-10(14)8-3-2-7(11)6-9(8)21(17,18)13-4-5-20(12,15)16/h2-3,6,13H,4-5,11H2,1H3,(H2,12,15,16) |
| InChIKey | KRMCWXRXMNLGTB-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 158.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|