methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate

C10H15N3O6S2 — CID 102930963

IUPACmethyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate
SMILESCOC(=O)c1ccc(N)cc1S(=O)(=O)NCCS(N)(=O)=O
InChIInChI=1S/C10H15N3O6S2/c1-19-10(14)8-3-2-7(11)6-9(8)21(17,18)13-4-5-20(12,15)16/h2-3,6,13H,4-5,11H2,1H3,(H2,12,15,16)
InChIKeyKRMCWXRXMNLGTB-UHFFFAOYSA-N
MW337.38 g/mol
LogP-1.38
Rot. Bonds6

About methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate

methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate (PubChem CID 102930963) has the molecular formula C10H15N3O6S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate.

Molecular Properties

Compound Namemethyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate
PubChem CID102930963
Molecular FormulaC10H15N3O6S2
Molecular Weight337.38 g/mol
Exact Mass337.04
IUPAC Namemethyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate
SMILESCOC(=O)c1ccc(N)cc1S(=O)(=O)NCCS(N)(=O)=O
InChIInChI=1S/C10H15N3O6S2/c1-19-10(14)8-3-2-7(11)6-9(8)21(17,18)13-4-5-20(12,15)16/h2-3,6,13H,4-5,11H2,1H3,(H2,12,15,16)
InChIKeyKRMCWXRXMNLGTB-UHFFFAOYSA-N
XLogP-1.38
TPSA158.65 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.38
LogP ≤ 5-1.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate?
The IUPAC name of methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate (CID 102930963) is methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate.
What is the SMILES notation for methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate?
The canonical SMILES for methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate is COC(=O)c1ccc(N)cc1S(=O)(=O)NCCS(N)(=O)=O.
What is the InChIKey of methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate?
The InChIKey is KRMCWXRXMNLGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O6S2/c1-19-10(14)8-3-2-7(11)6-9(8)21(17,18)13-4-5-20(12,15)16/h2-3,6,13H,4-5,11H2,1H3,(H2,12,15,16).
What are the key properties of methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate?
methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate has a molecular weight of 337.38 g/mol, XLogP of -1.38, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-2-(2-sulfamoylethylsulfamoyl)benzoate is sourced from PubChem (CID 102930963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).