C12H13N3O4S2 — CID 102931258
methyl 4-amino-2-(1,3-thiazol-4-ylmethylsulfamoyl)benzoate (PubChem CID 102931258) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is methyl 4-amino-2-(1,3-thiazol-4-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 4-amino-2-(1,3-thiazol-4-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 102931258 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | methyl 4-amino-2-(1,3-thiazol-4-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)NCc1cscn1 |
| InChI | InChI=1S/C12H13N3O4S2/c1-19-12(16)10-3-2-8(13)4-11(10)21(17,18)15-5-9-6-20-7-14-9/h2-4,6-7,15H,5,13H2,1H3 |
| InChIKey | MCSXQYWZFTVFNN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|