C10H14N2O5S — CID 102930876
methyl 4-amino-2-(2-hydroxyethylsulfamoyl)benzoate (PubChem CID 102930876) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 4-amino-2-(2-hydroxyethylsulfamoyl)benzoate.
| Compound Name | methyl 4-amino-2-(2-hydroxyethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 102930876 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl 4-amino-2-(2-hydroxyethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C10H14N2O5S/c1-17-10(14)8-3-2-7(11)6-9(8)18(15,16)12-4-5-13/h2-3,6,12-13H,4-5,11H2,1H3 |
| InChIKey | SUNADUDQJHEVND-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|