C10H15N3O6S2 — CID 102931171
4-amino-2-(3-sulfamoylpropylsulfamoyl)benzoic acid (PubChem CID 102931171) has the molecular formula C10H15N3O6S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-amino-2-(3-sulfamoylpropylsulfamoyl)benzoic acid.
| Compound Name | 4-amino-2-(3-sulfamoylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102931171 |
| Molecular Formula | C10H15N3O6S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-amino-2-(3-sulfamoylpropylsulfamoyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H15N3O6S2/c11-7-2-3-8(10(14)15)9(6-7)21(18,19)13-4-1-5-20(12,16)17/h2-3,6,13H,1,4-5,11H2,(H,14,15)(H2,12,16,17) |
| InChIKey | WHSQVVHBOUAAET-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|