C12H14N4O4S — CID 102931590
methyl 4-amino-2-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzoate (PubChem CID 102931590) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is methyl 4-amino-2-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-amino-2-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 102931590 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | methyl 4-amino-2-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)Nc1[nH]ncc1C |
| InChI | InChI=1S/C12H14N4O4S/c1-7-6-14-15-11(7)16-21(18,19)10-5-8(13)3-4-9(10)12(17)20-2/h3-6H,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | NRMVAENPHYQNSW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|