C12H15N3O4S — CID 115631172
2,5-dimethoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 115631172) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115631172 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,5-dimethoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2[nH]ncc2C)c1 |
| InChI | InChI=1S/C12H15N3O4S/c1-8-7-13-14-12(8)15-20(16,17)11-6-9(18-2)4-5-10(11)19-3/h4-7H,1-3H3,(H2,13,14,15) |
| InChIKey | WGYVWKNVLFQTKK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |