C11H14N4O3S — CID 104617179
3-amino-4-methoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 104617179) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-methoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104617179 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-amino-4-methoxy-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2[nH]ncc2C)cc1N |
| InChI | InChI=1S/C11H14N4O3S/c1-7-6-13-14-11(7)15-19(16,17)8-3-4-10(18-2)9(12)5-8/h3-6H,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | SCLNRPZJZBSIAR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|