C11H13N5O3S — CID 104617145
3-amino-4-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzamide (PubChem CID 104617145) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-amino-4-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzamide.
| Compound Name | 3-amino-4-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 104617145 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-amino-4-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]benzamide |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)c1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C11H13N5O3S/c1-6-5-14-15-11(6)16-20(18,19)9-3-2-7(10(13)17)4-8(9)12/h2-5H,12H2,1H3,(H2,13,17)(H2,14,15,16) |
| InChIKey | YICMSNUYLYPUPZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|