C11H11N5O3S — CID 81471489
3-amino-4-(pyrimidin-2-ylsulfamoyl)benzamide (PubChem CID 81471489) has the molecular formula C11H11N5O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-amino-4-(pyrimidin-2-ylsulfamoyl)benzamide.
| Compound Name | 3-amino-4-(pyrimidin-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 81471489 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-amino-4-(pyrimidin-2-ylsulfamoyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)Nc2ncccn2)c(N)c1 |
| InChI | InChI=1S/C11H11N5O3S/c12-8-6-7(10(13)17)2-3-9(8)20(18,19)16-11-14-4-1-5-15-11/h1-6H,12H2,(H2,13,17)(H,14,15,16) |
| InChIKey | SNKLLOZUDAOUIT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|