C9H9N5O4S2 — CID 102931797
methyl 4-amino-2-(thiatriazol-5-ylsulfamoyl)benzoate (PubChem CID 102931797) has the molecular formula C9H9N5O4S2 and a molecular weight of 315.34 g/mol. Its IUPAC name is methyl 4-amino-2-(thiatriazol-5-ylsulfamoyl)benzoate.
| Compound Name | methyl 4-amino-2-(thiatriazol-5-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 102931797 |
| Molecular Formula | C9H9N5O4S2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | methyl 4-amino-2-(thiatriazol-5-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H9N5O4S2/c1-18-8(15)6-3-2-5(10)4-7(6)20(16,17)12-9-11-13-14-19-9/h2-4H,10H2,1H3,(H,11,12,14) |
| InChIKey | ZEPGBBAEWSHMQX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|