C12H16FNO5S — CID 103837921
methyl 4-fluoro-2-(3-hydroxybutylsulfamoyl)benzoate (PubChem CID 103837921) has the molecular formula C12H16FNO5S and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl 4-fluoro-2-(3-hydroxybutylsulfamoyl)benzoate.
| Compound Name | methyl 4-fluoro-2-(3-hydroxybutylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 103837921 |
| Molecular Formula | C12H16FNO5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 4-fluoro-2-(3-hydroxybutylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)NCCC(C)O |
| InChI | InChI=1S/C12H16FNO5S/c1-8(15)5-6-14-20(17,18)11-7-9(13)3-4-10(11)12(16)19-2/h3-4,7-8,14-15H,5-6H2,1-2H3 |
| InChIKey | LKHZNVLMJRVKCM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |