C12H16FNO4S2 — CID 103837977
methyl 4-fluoro-2-(2-methylsulfanylpropylsulfamoyl)benzoate (PubChem CID 103837977) has the molecular formula C12H16FNO4S2 and a molecular weight of 321.40 g/mol. Its IUPAC name is methyl 4-fluoro-2-(2-methylsulfanylpropylsulfamoyl)benzoate.
| Compound Name | methyl 4-fluoro-2-(2-methylsulfanylpropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 103837977 |
| Molecular Formula | C12H16FNO4S2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | methyl 4-fluoro-2-(2-methylsulfanylpropylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)NCC(C)SC |
| InChI | InChI=1S/C12H16FNO4S2/c1-8(19-3)7-14-20(16,17)11-6-9(13)4-5-10(11)12(15)18-2/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | TXWMEXWTKXILAI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |