C11H14N2O7S — CID 123936352
(2S)-2-amino-5-(4-hydroxy-3-sulfoanilino)-5-oxopentanoic acid (PubChem CID 123936352) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is (2S)-2-amino-5-(4-hydroxy-3-sulfoanilino)-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(4-hydroxy-3-sulfoanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123936352 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2S)-2-amino-5-(4-hydroxy-3-sulfoanilino)-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)Nc1ccc(O)c(S(=O)(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C11H14N2O7S/c12-7(11(16)17)2-4-10(15)13-6-1-3-8(14)9(5-6)21(18,19)20/h1,3,5,7,14H,2,4,12H2,(H,13,15)(H,16,17)(H,18,19,20)/t7-/m0/s1 |
| InChIKey | KIBJVMHSIHMLLP-ZETCQYMHSA-N |
| XLogP | -0.23 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|